CymitQuimica logo

CAS 688735-57-1

:

(4R)-Tetrahydro-2H-1,3-thiazine-2,4-dicarboxylic acid

Description:
(4R)-Tetrahydro-2H-1,3-thiazine-2,4-dicarboxylic acid is a heterocyclic compound characterized by its thiazine ring structure, which incorporates both sulfur and nitrogen atoms. This compound features two carboxylic acid functional groups, contributing to its acidity and potential reactivity. The stereochemistry indicated by the (4R) designation suggests a specific three-dimensional arrangement of atoms, which can influence its biological activity and interactions with other molecules. The presence of the thiazine ring may impart unique properties, such as the ability to participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Additionally, the compound's solubility and stability can be affected by the carboxylic acid groups, which can engage in hydrogen bonding and ionic interactions. Overall, (4R)-Tetrahydro-2H-1,3-thiazine-2,4-dicarboxylic acid is of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for more complex molecules.
Formula:C6H9NO4S
InChI:InChI=1S/C6H9NO4S/c8-5(9)3-1-2-12-4(7-3)6(10)11/h3-4,7H,1-2H2,(H,8,9)(H,10,11)/t3-,4?/m1/s1
InChI key:InChIKey=QANKCBUMRYXIRY-SYPWQXSBSA-N
SMILES:C(O)(=O)[C@@H]1NC(C(O)=O)SCC1
Synonyms:
  • 2H-1,3-Thiazine-2,4-dicarboxylic acid, tetrahydro-, (4R)-
  • (4R)-Tetrahydro-2H-1,3-thiazine-2,4-dicarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.