CAS 688763-20-4

1-[2-(1H-pyrrol-1-yl)ethyl]piperazine

Description:

1-[2-(1H-pyrrol-1-yl)ethyl]piperazine, identified by its CAS number 688763-20-4, is a chemical compound characterized by its unique structure, which includes a piperazine ring and a pyrrole moiety. This compound typically exhibits properties associated with both heterocyclic amines and piperazine derivatives, making it of interest in medicinal chemistry and pharmacology. It is likely to be a colorless to light yellow liquid or solid, depending on its purity and form. The presence of the pyrrole ring suggests potential biological activity, as pyrrole derivatives are often involved in various biological processes. The compound may exhibit moderate solubility in polar solvents due to the presence of nitrogen atoms, which can engage in hydrogen bonding. Its potential applications could include roles as a pharmaceutical intermediate or in the development of novel therapeutic agents. However, specific biological activities, toxicity, and stability would require further investigation through empirical studies and characterization techniques.

Formula: C₁₀H₁₇N₃

InChI: InChI=1/C10H17N3/c1-2-6-12(5-1)9-10-13-7-3-11-4-8-13/h1-2,5-6,11H,3-4,7-10H2

SMILES: c1ccn(c1)CCN1CCNCC1

Synonyms:

• Piperazine, 1-[2-(1H-pyrrol-1-yl)ethyl]-
• 1-[2-(1H-Pyrrol-1-yl)ethyl]piperazine

1-[2-(1H-Pyrrol-1-yl)ethyl]piperazine

CAS: 688763-20-4

1-[2-(1H-Pyrrol-1-yl)ethyl]piperazine

Formula: C₁₀H₁₇N₃

Purity: 97%

Color and Shape: colourless to pale yellow liquid

Molecular weight: 179.26g/mol

Ref: 54-OR0959

1-(2-Pyrrol-1-yl-ethyl)piperazine

CAS: 688763-20-4

Formula: C₁₀H₁₇N₃

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 179.267

Ref: 10-F019447