CAS 68877-29-2
:Isobornylcyclohexanol
Description:
Isobornylcyclohexanol, with the CAS number 68877-29-2, is a bicyclic organic compound that belongs to the class of alcohols. It features a cyclohexanol structure with an isobornyl group, which contributes to its unique properties. This compound is typically characterized by its colorless to pale yellow liquid form and exhibits a pleasant, camphoraceous odor. Isobornylcyclohexanol is known for its solubility in organic solvents, while being less soluble in water, which is common for many alcohols with larger hydrophobic groups. It is often utilized in the fragrance and flavor industry due to its aromatic qualities. Additionally, it may serve as an intermediate in organic synthesis and has potential applications in the formulation of personal care products. The compound's stability and reactivity can be influenced by the presence of functional groups, making it a subject of interest in various chemical research and industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C16H28O
InChI:InChI=1/C16H28O/c1-15(2)12-6-9-14(16(15,3)10-12)11-4-7-13(17)8-5-11/h11-14,17H,4-10H2,1-3H3
SMILES:CC1(C)C2CCC(C3CCC(CC3)O)C1(C)C2
Synonyms:- (1,7,7-Trimethylbicyclo(2.2.1)hept-2-yl)cyclohexanol
- 4-(1,6,6-Trimethylbicyclo[3.1.1]Hept-2-Yl)Cyclohexanol
- Bornyl cyclohexanol
- Bornylcyclohexanol
- Cyclohexanol, (1,7,7-trimethylbicyclo(2.2.1)hept-2-yl)-
- Isobornylcyclohexanol
- Terusolve MTPH
- (1,7,7-Trimethylbicyclo(2.2.1)hept-2-yl)cyclohexan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.