CAS 688810-12-0

[4-(difluoromethoxy)phenyl]boronic acid

Description:

[4-(Difluoromethoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a difluoromethoxy group. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar organic solvents. The difluoromethoxy group enhances its electronic properties, making it useful in various applications, particularly in medicinal chemistry and materials science. Boronic acids are known for their ability to form reversible covalent bonds with diols, which is significant in the development of sensors and drug delivery systems. Additionally, this compound may participate in Suzuki-Miyaura cross-coupling reactions, facilitating the synthesis of complex organic molecules. Its reactivity and functionalization potential make it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices are followed.

Formula: C₇H₇BF₂O₃

InChI: InChI=1/C7H7BF2O3/c9-7(10)13-6-3-1-5(2-4-6)8(11)12/h1-4,7,11-12H

SMILES: c1cc(ccc1B(O)O)OC(F)F

Synonyms:

• boronic acid, B-[4-(difluoromethoxy)phenyl]-
• 4-Difluoromethoxyphenylboronic acid
• 4-Difluoromethoxy-Phenylboronic Acid

(4-(Difluoromethoxy)phenyl)boronic acid

CAS: 688810-12-0

Formula: C₇H₇BF₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 187.9365

Ref: IN-DA0033TB

4-(Difluoromethoxy)benzeneboronic acid

CAS: 688810-12-0

4-(Difluoromethoxy)benzeneboronic acid

Formula: C₇H₇BF₂O₃

Purity: 97%

Color and Shape: white. lumpy powder

Molecular weight: 187.94g/mol

Ref: 54-PC1431

(4-(Difluoromethoxy)phenyl)boronic acid

CAS: 688810-12-0

Purity: 98%

Molecular weight: 187.94

Ref: 10-F222865

4-(Difluoromethoxy)phenylboronic acid

CAS: 688810-12-0

Please enquire for more information about 4-(Difluoromethoxy)phenylboronic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₇H₇BF₂O₃

Purity: Min. 95%

Molecular weight: 187.94 g/mol

Ref: 3D-FD84580