CAS 68889-62-3

1-Hexanol, 3-amino-, hydrochloride, (S)-

Description:

1-Hexanol, 3-amino-, hydrochloride, (S)- is a chiral amine derivative characterized by its long carbon chain and amino functional group. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals and organic synthesis. The presence of the hexanol moiety contributes to its hydrophobic characteristics, while the amino group introduces basicity and potential for hydrogen bonding. This compound is often utilized in the synthesis of more complex molecules, including pharmaceuticals, due to its ability to act as a building block. The (S)- designation indicates its specific stereochemistry, which is crucial in biological systems where chirality can influence the activity and interaction of the molecule with biological targets. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₆H₁₅NO·ClH

InChI: InChI=1S/C6H15NO.ClH/c1-2-3-6(7)4-5-8;/h6,8H,2-5,7H2,1H3;1H/t6-;/m0./s1

InChI key: InChIKey=LWUKXXYWSXUWIF-RGMNGODLSA-N

SMILES: [C@H](CCC)(CCO)N.Cl

Synonyms:

• 1-Hexanol, 3-amino-, hydrochloride, (S)-
• (S)-3-Aminohexan-1-ol hydrochloride

(S)-3-Aminohexan-1-ol hydrochloride

CAS: 68889-62-3

Formula: C₆H₁₆ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 153.6503

Ref: IN-DA00FE3E

(S)-3-Aminohexan-1-ol hydrochloride

CAS: 68889-62-3

(S)-3-Aminohexan-1-ol hydrochloride

Purity: 98%

Ref: 54-OR1039910

(S)-3-Aminohexan-1-ol hydrochloride

CAS: 68889-62-3

Formula: C₆H₁₆ClNO

Purity: 98%

Molecular weight: 153.65

Ref: 10-F237691

(S)-3-Aminohexan-1-ol Hydrochloride

Controlled Product

CAS: 68889-62-3

Formula: C₆H₁₅NO•HCl

Color and Shape: Neat

Molecular weight: 153.65

Ref: TR-S292730