CAS 6889-78-7
:3-Hydroxy-4'-methoxyflavone
Description:
3-Hydroxy-4'-methoxyflavone, with the CAS number 6889-78-7, is a flavonoid compound characterized by its phenolic structure, which includes a chromone backbone. This compound features a hydroxyl group at the 3-position and a methoxy group at the 4'-position of the flavone structure, contributing to its potential biological activities. Flavonoids, including this compound, are known for their antioxidant properties, which can help in neutralizing free radicals and reducing oxidative stress. Additionally, 3-Hydroxy-4'-methoxyflavone may exhibit anti-inflammatory, antimicrobial, and anticancer activities, making it of interest in pharmacological research. The compound is typically soluble in organic solvents and may have limited solubility in water, which is common for many flavonoids. Its structural characteristics and potential health benefits make it a subject of study in various fields, including medicinal chemistry and natural product research. However, further studies are necessary to fully elucidate its mechanisms of action and therapeutic potential.
Formula:C16H12O4
InChI:InChI=1/C16H12O4/c1-19-11-8-6-10(7-9-11)16-15(18)14(17)12-4-2-3-5-13(12)20-16/h2-9,18H,1H3
SMILES:COc1ccc(cc1)c1c(c(=O)c2ccccc2o1)O
Synonyms:- 4'-Methoxyflavonol
- Nsc 102030
- 4H-1-Benzopyran-4-one, 3-hydroxy-2-(4-methoxyphenyl)- (9CI)
- 3-hydroxy-2-(4-methoxyphenyl)-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Hydroxy-4'-methoxyflavone
CAS:Formula:C16H12O4Purity:>98.0%(HPLC)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:268.273-Hydroxy-4-methoxyflavone
CAS:Formula:C16H12O4Purity:98%Color and Shape:SolidMolecular weight:268.26413-Hydroxy-4'-methoxyflavone
CAS:3-Hydroxy-4'-methoxyflavonePurity:≥95%Color and Shape:SolidMolecular weight:268.26g/mol4'-Methoxyflavonol
CAS:4'-Methoxyflavonol is a synthetic flavonol that interacts with the lipid bilayer of DPPC model membranes, and is antioxidant and antiproliferative .Formula:C16H12O4Purity:98.86%Color and Shape:SolidMolecular weight:268.264'-Methoxyflavonol
CAS:4'-Methoxyflavonol is a flavonoid compound, which is a naturally occurring secondary metabolite primarily found in various plant species. It is characterized by the presence of a methoxy group attached to the flavonol backbone, contributing to its unique chemical properties. Through its antioxidant activity, 4'-Methoxyflavonol plays a crucial role in neutralizing free radicals and reducing oxidative stress within cells.Formula:C16H12O4Purity:Min. 95%Molecular weight:268.26 g/mol





