CAS 68897-50-7
:3,4-dimethyl-2,6-dinitro-N-nitroso-N-(pentan-3-yl)aniline
Description:
3,4-Dimethyl-2,6-dinitro-N-nitroso-N-(pentan-3-yl)aniline, with the CAS number 68897-50-7, is a chemical compound that belongs to the class of nitroanilines. This substance features multiple functional groups, including nitro groups and a nitroso group, which contribute to its reactivity and potential applications in various chemical processes. The presence of the dimethyl and pentan-3-yl substituents indicates that it has a complex structure, which may influence its physical properties such as solubility, melting point, and boiling point. Typically, compounds with nitro groups are known for their explosive properties, and safety precautions are essential when handling such materials. Additionally, the compound may exhibit specific biological activities, making it of interest in fields such as pharmaceuticals or agrochemicals. However, due to the presence of potentially hazardous groups, it is crucial to assess its toxicity and environmental impact thoroughly. Proper storage and handling protocols should be followed to ensure safety in laboratory or industrial settings.
Formula:C13H18N4O5
InChI:InChI=1/C13H18N4O5/c1-5-10(6-2)15(14-18)13-11(16(19)20)7-8(3)9(4)12(13)17(21)22/h7,10H,5-6H2,1-4H3
SMILES:CCC(CC)N(c1c(cc(C)c(C)c1N(=O)=O)N(=O)=O)N=O
Synonyms:- benzenamine, N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitro-N-nitroso-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pendimethalin-N-Nitroso
CAS:Formula:C13H18N4O5Color and Shape:Yellow CrystallineMolecular weight:310.30N-Nitrosopendimethalin
CAS:N-Nitrosopendimethalin is a potent inhibitor of kinase activity, which is essential for the function of many proteins in the human body. It is an analog of a medicinal compound that has been shown to induce tumor cell apoptosis and has potential as an anticancer agent. N-Nitrosopendimethalin inhibits the activity of Chinese hamster ovary cell kinases, which are involved in cancer cell proliferation and survival. This compound has also been detected in urine samples, indicating its potential as a biomarker for cancer diagnosis and monitoring. As an inhibitor of protein kinases, N-Nitrosopendimethalin shows promise as a therapeutic agent for various types of cancer.
Formula:C13H18N4O5Purity:Min. 95%Molecular weight:310.31 g/mol


