CAS 689-31-6
:β-Ketoadipic acid
Description:
β-Ketoadipic acid, also known as 3-oxoadipic acid, is a dicarboxylic acid characterized by the presence of two carboxyl groups (-COOH) and a ketone group (C=O) within its structure. It is a colorless to pale yellow crystalline solid that is soluble in water and exhibits a slightly acidic nature due to its carboxylic acid groups. The compound plays a significant role in biochemical pathways, particularly in the metabolism of lysine and tryptophan. β-Ketoadipic acid is also involved in various synthetic processes, serving as an intermediate in the production of other chemical compounds. Its molecular structure allows for various functional group transformations, making it a valuable compound in organic synthesis. Additionally, it has applications in research related to metabolic disorders and enzymatic reactions. Safety data indicates that, while it should be handled with care due to its acidic properties, it is not classified as highly hazardous. Overall, β-Ketoadipic acid is an important compound in both biological and synthetic chemistry contexts.
Formula:C6H8O5
InChI:InChI=1S/C6H8O5/c7-4(3-6(10)11)1-2-5(8)9/h1-3H2,(H,8,9)(H,10,11)
InChI key:InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(CC(O)=O)=O
Synonyms:- 3-Ketoadipic acid
- 3-Oxohexanedioate
- 3-Oxohexanedioic acid
- B-ketoadipic acid
- Hexanedioic acid, 3-oxo-
- NSC 18511
- β-Oxoadipic acid
- 3-Oxoadipic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Oxohexanedioic Acid
CAS:<p>Applications 3-Oxohexanedioic Acid is a degradation product of catechol in the presence of hydrogen peroxide; Also, it is derived from 3-Oxohexanedioic Acid Diethyl Ester (O856830), which is an intermediate used to prepare CMPF (C595000) which is a drug-binding inhibitor which is also a constituent of urine. CMPF can inhibit specific T4 binding in serum by increasing the free concentration of direct competitors.<br>References Gogoi, A., et al.: Chem. Eng. J., 311, 153-162 (2017); Mabuchi, H., Nakahashi, H.: Nephron, 44, 277 (1986); Lim, C.F., et. al.: Metabolism Clin. Exp., 42, 1468 (1993)<br></p>Formula:C6H8O5Color and Shape:Off White SolidMolecular weight:160.1253-Oxohexanedioic Acid
CAS:<p>3-Oxohexanedioic Acid is a benzoate metabolite of 3-hydroxybenzoic acid. It is enzymatically converted from 3-hydroxybenzoic acid by the enzyme protocatechuate 3,4 dioxygenase. This conversion requires molecular oxygen and NADPH as cofactors. The enzyme activity of this process is inhibited by sulfa drugs such as sulfadiazine and sulfamethoxazole. The physiological function of 3-oxohexanedioic acid has not been determined, although it has been shown to inhibit transcriptional regulation in vitro and to be involved in dinucleotide phosphate metabolism in vivo.</p>Formula:C6H8O5Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:160.12 g/mol



