CAS 6890-93-3
:Retin-3,15-diol
Description:
Retin-3,15-diol, with the CAS number 6890-93-3, is a derivative of vitamin A, specifically a form of retinol. This compound is characterized by its structure, which includes multiple double bonds and hydroxyl groups, contributing to its reactivity and biological activity. It is typically a yellow to orange solid or oil, depending on its purity and formulation. Retin-3,15-diol is known for its role in various biological processes, particularly in vision and cellular growth. It exhibits antioxidant properties and is often studied for its potential therapeutic applications in dermatology, particularly in the treatment of skin conditions such as acne and photoaging. The compound is sensitive to light and air, which can lead to degradation, necessitating careful handling and storage. In terms of solubility, it is generally soluble in organic solvents but less so in water. Overall, Retin-3,15-diol is an important compound in both biological research and cosmetic formulations due to its beneficial effects on skin health.
Formula:C20H30O2
InChI:InChI=1/C20H30O2/c1-15(7-6-8-16(2)11-12-21)9-10-19-17(3)13-18(22)14-20(19,4)5/h6-11,18,21-22H,12-14H2,1-5H3/b8-6+,10-9+,15-7+,16-11+
InChI key:InChIKey=OBODKGDXEIUEIH-DAWLFQHYNA-N
SMILES:C(=C/C(=C/C=C/C(=C/CO)/C)/C)\C=1C(C)(C)CC(O)CC1C
Synonyms:- Retin-3,15-diol
- Retinol, 3-hydroxy-
- Hydroxyretinol
- 3-Hydroxyretinol
- Retinol, 3-hydroxy-, all-trans-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
