CymitQuimica logo

CAS 68906-26-3

:

Benzenemethanamine, a-(1-methylethyl)-, (S)-

Description:
Benzenemethanamine, α-(1-methylethyl)-, (S)-, also known by its CAS number 68906-26-3, is an organic compound characterized by its amine functional group and a chiral center, which gives it specific stereochemical properties. This compound features a benzene ring attached to a methanamine group, with an isopropyl substituent at the alpha position relative to the amine. As a chiral molecule, it exists in two enantiomeric forms, with the (S)- configuration being one of them, which can influence its biological activity and interactions. The presence of the isopropyl group contributes to its hydrophobic characteristics, while the amine group can engage in hydrogen bonding, affecting its solubility in various solvents. This compound may be of interest in pharmaceutical applications due to its potential biological activity, and its properties can be influenced by factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H15N
InChI:InChI=1S/C10H15N/c1-8(2)10(11)9-6-4-3-5-7-9/h3-8,10H,11H2,1-2H3/t10-/m0/s1
InChI key:UVXXBSCXKKIBCH-JTQLQIEISA-N
SMILES:CC(C)[C@@H](C1=CC=CC=C1)N
Found 4 products.