CAS 68922-18-9: 2-Pyridineethanesulfonic acid
Description:2-Pyridineethanesulfonic acid, with the CAS number 68922-18-9, is an organic compound characterized by its sulfonic acid functional group attached to a pyridine ring and an ethyl chain. This compound is typically a white to off-white solid and is soluble in water, making it useful in various biochemical applications. It exhibits acidic properties due to the presence of the sulfonic acid group, which can donate protons in solution. 2-Pyridineethanesulfonic acid is often utilized as a buffering agent in biological and chemical experiments, particularly in maintaining pH stability in enzymatic reactions. Its structure allows it to interact with biological molecules, making it relevant in studies involving protein interactions and enzyme activity. Additionally, it may serve as a reagent in organic synthesis and analytical chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C7H9NO3S
InChI:InChI=1S/C7H9NO3S/c9-12(10,11)6-4-7-3-1-2-5-8-7/h1-3,5H,4,6H2,(H,9,10,11)
InChI key:InChIKey=VRBVUAYEXFCDPE-UHFFFAOYSA-N
SMILES:O=S(=O)(O)CCC1=NC=CC=C1
- Synonyms:
- 2-(2-Pyridyl)ethanesulfonic acid
- 2-(Pyridin-2-Yl)Ethanesulfonic Acid
- 2-Pyridin-2-ylethanesulfonic acid
- 2-Pyridylethanesulfonic acid
- NSC 87861
- 2-Pyridineethanesulfonic acid

2-(2-PYRIDYL)ETHANESULFONIC ACID
Ref: IN-DA003ESP
1g | 49.00 € | ||
5g | 88.00 € |

2-(2-Pyridyl)ethanesulfonic Acid
Ref: 3B-P0352
5g | 44.00 € | ||
25g | 114.00 € |

2-(2-Pyridyl)ethanesulfonic acid
Ref: 10-F342216
5g | To inquire | ||
25g | To inquire |

2-(2-Pyridyl)ethanesulfonic acid
Ref: 3D-TCA92218
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
2500mg | Discontinued | Request information |