CAS 689260-53-5

2-bromo-5-iodo-1,3-dimethylbenzene

Description:

2-Bromo-5-iodo-1,3-dimethylbenzene, with the CAS number 689260-53-5, is an aromatic compound characterized by the presence of both bromine and iodine substituents on a dimethylbenzene framework. This compound features a benzene ring with two methyl groups located at the 1 and 3 positions, which contribute to its overall hydrophobic character and influence its reactivity. The bromine atom is positioned at the 2 position, while the iodine atom is at the 5 position, creating a unique steric and electronic environment. This substitution pattern can affect the compound's physical properties, such as melting and boiling points, as well as its solubility in various solvents. Additionally, the presence of halogens like bromine and iodine can enhance the compound's reactivity in nucleophilic substitution reactions and other organic transformations. Overall, 2-bromo-5-iodo-1,3-dimethylbenzene is of interest in synthetic organic chemistry and may serve as an intermediate in the synthesis of more complex molecules.

Formula: C₈H₈BrI

InChI: InChI=1/C8H8BrI/c1-5-3-7(10)4-6(2)8(5)9/h3-4H,1-2H3

SMILES: Cc1cc(cc(C)c1Br)I

Synonyms:

• 2,6-Dimethyl-4-iodobromobenzene
• Benzene, 2-bromo-5-iodo-1,3-dimethyl-

2-Bromo-5-iodo-1,3-dimethylbenzene

CAS: 689260-53-5

Formula: C₈H₈BrI

Purity: 95%

Color and Shape: Liquid

Molecular weight: 310.9576

Ref: IN-DA0036PR

2-Bromo-5-iodo-1,3-dimethylbenzene

CAS: 689260-53-5

2-Bromo-5-iodo-1,3-dimethylbenzene

Purity: 98%

Molecular weight: 310.96g/mol

Ref: 54-OR1010347

2-Bromo-5-iodo-m-xylene

CAS: 689260-53-5

Formula: C₈H₈BrI

Purity: 95%

Color and Shape: Liquid, Clear

Molecular weight: 310.96

Ref: 10-F037659