CymitQuimica logo

CAS 689277-04-1

:

4-Quinolinamine, 2,5,7-trimethyl-

Description:
4-Quinolinamine, 2,5,7-trimethyl- is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features three methyl groups located at the 2, 5, and 7 positions of the quinoline ring, contributing to its unique chemical properties. The presence of the amino group (-NH2) at the 4-position enhances its reactivity, making it a potential candidate for various chemical reactions, including those involving nucleophilic substitution. The trimethyl substitution can influence the compound's solubility, stability, and biological activity. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential applications in dye synthesis, agrochemicals, or as intermediates in organic synthesis. As with many nitrogen-containing heterocycles, the compound may also display fluorescence or other optical properties, which can be useful in various analytical applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H14N2
InChI:InChI=1S/C12H14N2/c1-7-4-8(2)12-10(13)6-9(3)14-11(12)5-7/h4-6H,1-3H3,(H2,13,14)
InChI key:InChIKey=BGNKCOXXDCIDPY-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=C(C)C=C2C)N=C(C)C1
Synonyms:
  • 4-Quinolinamine, 2,5,7-trimethyl-
  • 2,5,7-Trimethylquinolin-4-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.