CAS 68929-05-5
:Deuteroporphyrin IX dihydrochloride
Description:
Deuteroporphyrin IX dihydrochloride is a synthetic derivative of porphyrin, characterized by its complex cyclic structure that includes a central metal ion, typically iron or zinc, which can influence its chemical properties and biological activity. This compound is known for its deep red color, a characteristic feature of porphyrins due to their ability to absorb visible light. Deuteroporphyrin IX dihydrochloride is soluble in water and polar organic solvents, making it useful in various biochemical applications. It exhibits strong absorbance in the UV-visible spectrum, particularly in the Soret band region, which is significant for photodynamic therapy and other photochemical applications. Additionally, it can participate in redox reactions and has potential roles in biological systems, including as a photosensitizer. Its dihydrochloride form indicates the presence of two hydrochloride ions, which can affect its solubility and stability. Overall, Deuteroporphyrin IX dihydrochloride is a valuable compound in both research and clinical settings, particularly in the fields of biochemistry and medicinal chemistry.
Formula:C30H32Cl2N4O4
InChI:InChI=1/C30H28N4O4.2ClH/c1-15-9-20-12-25-17(3)21(5-7-29(35)36)27(33-25)14-28-22(6-8-30(37)38)18(4)26(34-28)13-24-16(2)10-19(32-24)11-23(15)31-20;;/h9-14H,5-8H2,1-4H3,(H,35,36)(H,37,38);2*1H/b19-11-,20-12-,23-11u,24-13u,25-12u,26-13-,27-14-,28-14u;;
InChI key:InChIKey=CRUCDRBIKFXOMR-YJKKSLNZSA-N
SMILES:C(CC(O)=O)C1=C2C=C3C(CCC(O)=O)=C(C)C(=N3)C=C4NC(=CC5=NC(=CC(N2)=C1C)C(C)=C5)C(C)=C4.Cl
Synonyms:- 21H,23H-Porphine-2,18-dipropanoic acid, 3,7,12,17-tetramethyl-, hydrochloride (1:2)
- Deuteroporphyrin IX dihydrochloride
- 21H,23H-Porphine-2,18-dipropanoic acid, 3,7,12,17-tetramethyl-, dihydrochloride
- 3,3'-(3,7,12,17-Tetramethylporphyrin-2,18-Diyl)Dipropanoic Acid
- 3,7,12,17-Tetramethyl-21H,23H-porphine-2,18-dipropionic acid dihydrochloride
- 3-[18-(2-carboxyethyl)-3,8,13,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoic acid
- deuteroporphyrinix2HCl
- 3,7,12,17-Tetramethyl-21H,23H-porphine-2,18-dipropanoic acid hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Deuteroporphyrin IX dihydrochloride
CAS:Deuteroporphyrin IX (dihydrochloride) is a photosensitizer known for its high lipophilicity and amphiphilicity, which enables it to impart photosensitivity to cell membrane systems. Additionally, Deuteroporphyrin IX (dihydrochloride) can induce irreversible discharge elimination in individual neurons.Formula:C30H32Cl2N4O4Color and Shape:SolidMolecular weight:583.51Deuteroporphyrin IX dihydrochloride
CAS:Please enquire for more information about Deuteroporphyrin IX dihydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C30H32Cl2N4O4Purity:Min. 95%Molecular weight:583.51 g/molRef: 4Z-H-042015
Discontinued product



