
CAS 689290-85-5
:6-Bromo-2-naphthaleneethanol
Description:
6-Bromo-2-naphthaleneethanol is an organic compound characterized by its structure, which features a naphthalene ring substituted with a bromine atom and a hydroxyl group. This compound is part of the naphthalene derivatives, known for their aromatic properties and potential applications in various fields, including pharmaceuticals and materials science. The presence of the bromine atom enhances its reactivity, making it a useful intermediate in organic synthesis. The hydroxyl group contributes to its solubility in polar solvents and can participate in hydrogen bonding, influencing its physical properties such as melting and boiling points. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its CAS number, 689290-85-5, allows for precise identification and retrieval of information regarding its safety, handling, and regulatory status. Overall, 6-Bromo-2-naphthaleneethanol is a versatile compound with significant implications in chemical research and application.
Formula:C12H11BrO
InChI:InChI=1S/C12H11BrO/c13-12-4-3-10-7-9(5-6-14)1-2-11(10)8-12/h1-4,7-8,14H,5-6H2
InChI key:InChIKey=ZYHQAPDVLIKKOX-UHFFFAOYSA-N
SMILES:C(CO)C1=CC2=C(C=C1)C=C(Br)C=C2
Synonyms:- 2-(6-Bromo-2-naphthyl)ethanol
- 2-(6-Bromonaphthalen-2-yl)ethanol
- 6-Bromo-2-naphthaleneethanol
- 2-Naphthaleneethanol, 6-bromo-
- 2-(6-Bromonaphthalen-2-yl)ethan-1-ol
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery