CAS 689291-89-2

5-Bromo-2-iodobenzaldehyde

Description:

5-Bromo-2-iodobenzaldehyde is an organic compound characterized by the presence of both bromine and iodine substituents on a benzaldehyde ring. Its molecular structure features a benzene ring with a formyl group (-CHO) and halogen atoms at the 2 and 5 positions, which significantly influence its reactivity and properties. This compound is typically a solid at room temperature and may exhibit a pale yellow to brown color. It is known for its use in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the aldehyde group and the halogen atoms, which can participate in various chemical reactions such as nucleophilic substitutions and coupling reactions. Additionally, 5-Bromo-2-iodobenzaldehyde may have specific solubility characteristics, often being soluble in organic solvents like dichloromethane and ethanol, while being less soluble in water. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of halogens.

Formula: C₇H₄BrIO

InChI: InChI=1/C7H4BrIO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H

SMILES: c1cc(c(cc1Br)C=O)I

Synonyms:

• Benzaldehyde, 5-Bromo-2-Iodo-
• 5-Bromo-2-iodobenzaldehyde

5-Bromo-2-iodobenzaldehyde

CAS: 689291-89-2

Formula: C₇H₄BrIO

Purity: 96%

Color and Shape: Solid

Molecular weight: 310.9145

Ref: IN-DA006FBY

5-Bromo-2-iodobenzaldehyde

CAS: 689291-89-2

5-Bromo-2-iodobenzaldehyde

Formula: C₇H₄BrIO

Purity: ≥95%

Color and Shape: light yellow to orange crystalline powder

Molecular weight: 310.91g/mol

Ref: 54-OR40680

5-Bromo-2-iodobenzaldehyde

CAS: 689291-89-2

Formula: C₇H₄BrIO

Purity: 96%

Color and Shape: Solid

Molecular weight: 310.916

Ref: 10-F043445