CAS 68936-43-6
:N-[(1,2-Benzisoxazol-3-ylmethyl)sulfonyl]acetamide
Description:
N-[(1,2-Benzisoxazol-3-ylmethyl)sulfonyl]acetamide, with the CAS number 68936-43-6, is a chemical compound characterized by its unique structural features, including a benzisoxazole moiety and a sulfonamide functional group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the sulfonamide group, which can engage in hydrogen bonding. The benzisoxazole ring contributes to its potential biological activity, often associated with various pharmacological effects. The sulfonyl group enhances the compound's reactivity, making it a candidate for further chemical modifications or applications in medicinal chemistry. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, N-[(1,2-Benzisoxazol-3-ylmethyl)sulfonyl]acetamide represents a class of compounds that may have applications in drug development and other chemical research fields.
Formula:C10H10N2O4S
InChI:InChI=1S/C10H10N2O4S/c1-7(13)12-17(14,15)6-9-8-4-2-3-5-10(8)16-11-9/h2-5H,6H2,1H3,(H,12,13)
InChI key:InChIKey=HXFUTAFSEXINIW-UHFFFAOYSA-N
SMILES:C(S(NC(C)=O)(=O)=O)C=1C=2C(ON1)=CC=CC2
Synonyms:- N-[(1,2-Benzisoxazol-3-ylmethyl)sulfonyl]acetamide
- 1,2-Benzisoxazole, acetamide deriv.
- N-Acetyl-3-(sulfamoylmethyl)-1,2-benzisoxazole
- Acetamide, N-[(1,2-benzisoxazol-3-ylmethyl)sulfonyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Acetyl Zonisamide
CAS:Controlled ProductApplications A metabolite of Zonisamide (Z700000), a new anticonvulsant.
References Perchalski, R. J., et al.: J. Clin. Pharmacol., 26, 435 (1986), Stiff, D.D., et al.: Drug Metab. Disp., 18, 888 (1990),Formula:C10H10N2O4SColor and Shape:NeatMolecular weight:254.26N-Acetyl zonisamide
CAS:N-Acetyl zonisamide is a drug that is used in the treatment of epilepsy. It has a broad spectrum of activity and has been shown to be effective against seizures caused by both genetic and acquired conditions. N-Acetyl zonisamide's mechanism of action is not fully understood, but it may involve inhibition of carbonic anhydrase, modulation of serotonergic systems, and antagonism at adenosine receptors. Zonisamide also binds to glutamate and dopamine receptors in the brain, which may contribute to its clinical effects.
Formula:C10H10N2O4SPurity:Min. 95%Color and Shape:PowderMolecular weight:254.26 g/mol



