CAS 6894-38-8
:Jasmonic acid
Description:
Jasmonic acid is a plant hormone belonging to the jasmonate family, primarily involved in regulating various physiological processes, including growth, development, and stress responses. It is a cyclopentane derivative with a structure characterized by a cyclopentane ring and a carboxylic acid functional group. Jasmonic acid plays a crucial role in plant defense mechanisms, particularly in response to biotic stressors such as herbivory and pathogen attack, by activating defense-related genes and pathways. It is also involved in regulating processes like flower development, fruit ripening, and senescence. The compound is typically synthesized in plants from linolenic acid through a series of enzymatic reactions. Jasmonic acid can exist in various forms, including its methyl ester, which is biologically active and often used in research to study plant responses. Its CAS number, 6894-38-8, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. Overall, jasmonic acid is essential for maintaining plant health and adapting to environmental challenges.
Formula:C12H18O3
InChI:InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10-/m1/s1
InChI key:InChIKey=ZNJFBWYDHIGLCU-HWKXXFMVSA-N
SMILES:C(C(O)=O)[C@@H]1[C@@H](C/C=C\CC)C(=O)CC1
Synonyms:- (1R,2R)-3-Oxo-2-(2Z)-2-penten-1-ylcyclopentaneacetic acid
- (1R,2R)-Jasmonic acid
- (3R,7R)(-)-Jasmonic acid
- Cyclopentaneacetic acid, 3-oxo-2-(2-pentenyl)-, (Z)-trans-
- Cyclopentaneacetic acid, 3-oxo-2-(2-pentenyl)-, [1R-[1α,2β(Z)]]-
- Cyclopentaneacetic acid, 3-oxo-2-(2Z)-2-penten-1-yl-, (1R,2R)-
- Cyclopentaneacetic acid, 3-oxo-2-(2Z)-2-pentenyl-, (1R,2R)-
- Jasmonic acid
- {(1R,2R)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Jasmonic acid
CAS:Jasmonic acid (JA) is a plant growth regulator involved in plant defense and growth and development.Jasmonic acid induces calcium channels to function.Formula:C12H18O3Purity:>99.99%Color and Shape:SolidMolecular weight:210.27(Z)-2-(2-(But-2-en-1-yl)-4-oxocyclopentyl)-acetic acid
CAS:(Z)-2-(2-(But-2-en-1-yl)-4-oxocyclopentyl)-acetic acid is a synthetic compound, which is a derivative of cyclopentanone with an acetic acid moiety. This compound is typically synthesized in laboratory settings, originating from controlled chemical reactions, and not found naturally. The mode of action of (Z)-2-(2-(But-2-en-1-yl)-4-oxocyclopentyl)-acetic acid involves potential modulation of specific biological pathways, which could include acting as an enzyme inhibitor or interacting with cellular receptors.Formula:C12H18O3Purity:Min. 95%Molecular weight:210.27 g/mol



