
CAS 68978-03-0
:Hispaglabridin A
Description:
Hispaglabridin A is a natural compound classified as a flavonoid, specifically a type of polyphenolic compound. It is derived from certain plant species, particularly those in the genus *Hispanica*. This compound is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. Its structure features multiple hydroxyl groups, which contribute to its reactivity and ability to scavenge free radicals. The presence of these functional groups also enhances its solubility in polar solvents. Research has indicated that Hispaglabridin A may have therapeutic potential, particularly in the context of chronic diseases linked to oxidative stress. Additionally, its unique chemical structure may allow for interactions with various biological targets, making it a subject of interest in pharmacological studies. However, further research is necessary to fully elucidate its mechanisms of action and potential applications in medicine. As with many natural products, the extraction and purification processes can influence its availability and efficacy in research and therapeutic contexts.
Formula:C25H28O4
InChI:InChI=1S/C25H28O4/c1-15(2)5-7-19-21(26)9-8-18(23(19)27)17-13-16-6-10-22-20(24(16)28-14-17)11-12-25(3,4)29-22/h5-6,8-12,17,26-27H,7,13-14H2,1-4H3/t17-/m0/s1
InChI key:InChIKey=HZHXMXSXYQCAIG-KRWDZBQOSA-N
SMILES:CC1(C)OC2=C(C3=C(C[C@@H](CO3)C4=C(O)C(CC=C(C)C)=C(O)C=C4)C=C2)C=C1
Synonyms:- 2H,8H-Benzo[1,2-b:3,4-b′]dipyran, 1,3-benzenediol deriv.
- 1,3-Benzenediol, 4-[(3R)-3,4-dihydro-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b′]dipyran-3-yl]-2-(3-methyl-2-butenyl)-
- 1,3-Benzenediol, 4-(3,4-dihydro-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b′]dipyran-3-yl)-2-(3-methyl-2-butenyl)-, (R)-
- 1,3-Benzenediol, 4-[(3R)-3,4-dihydro-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b′]dipyran-3-yl]-2-(3-methyl-2-buten-1-yl)-
- 4-[(3R)-3,4-Dihydro-8,8-dimethyl-2H,8H-benzo[1,2-b:3,4-b′]dipyran-3-yl]-2-(3-methyl-2-buten-1-yl)-1,3-benzenediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Hispaglabridin A
CAS:Hispaglabridin A, an effective antioxidant, inhibits lipid peroxidation [1].Formula:C25H28O4Color and Shape:SolidMolecular weight:392.49
