CAS 68981-86-2
:3-(4,4-dimethyl-4,5-dihydro-1,3-oxazol-2-yl)pyridine
Description:
3-(4,4-Dimethyl-4,5-dihydro-1,3-oxazol-2-yl)pyridine, with the CAS number 68981-86-2, is a heterocyclic organic compound featuring both pyridine and oxazole functional groups. This compound typically exhibits characteristics common to nitrogen-containing heterocycles, such as moderate polarity and potential for hydrogen bonding due to the presence of nitrogen atoms. The oxazole ring contributes to its reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The dimethyl substitution on the oxazole ring can enhance lipophilicity, potentially affecting its solubility and permeability in biological systems. Additionally, the compound may display unique electronic properties due to the conjugation between the pyridine and oxazole moieties. Its synthesis and applications could be relevant in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological activity and chemical reactivity. As with many heterocycles, it may also exhibit fluorescence or other photophysical properties, which can be useful in various analytical applications.
Formula:C10H12N2O
InChI:InChI=1/C10H12N2O/c1-10(2)7-13-9(12-10)8-4-3-5-11-6-8/h3-6H,7H2,1-2H3
SMILES:CC1(C)COC(=N1)c1cccnc1
Synonyms:- 4,5-Dihydro-4,4-dimethyl-2-(3-pyridyl)oxazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(4,4-Dimethyl-2-oxazolinyl)pyridine, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H12N2OPurity:97%Color and Shape:Clear colorless, LiquidMolecular weight:176.22Pyridine, 3-(4,5-dihydro-4,4-dimethyl-2-oxazolyl)-
CAS:Formula:C10H12N2OPurity:97%Color and Shape:LiquidMolecular weight:176.21513-(4,5-Dihydro-4,4-dimethyl-1,3-oxazol-2-yl)pyridine
CAS:<p>3-(4,5-Dihydro-4,4-dimethyl-1,3-oxazol-2-yl)pyridine</p>Formula:C10H12N2OPurity:≥95%Color and Shape: solidMolecular weight:176.22g/mol3-(4,4-dimethyl-4,5-dihydro-1,3-oxazol-2-yl)pyridine
CAS:Formula:C10H12N2OPurity:97%Molecular weight:176.219



