
CAS 68988-57-8
:Silicic acid (H4SiO4), tetraethyl ester, reaction products with chlorodimethylsilane
Description:
Silicic acid (H4SiO4), tetraethyl ester, reaction products with chlorodimethylsilane, identified by CAS number 68988-57-8, are part of a class of organosilicon compounds that exhibit unique properties due to their silicon-oxygen framework. These compounds typically possess a silicate structure, where silicon atoms are bonded to oxygen atoms, forming a network that can incorporate organic groups. The presence of tetraethyl ester groups contributes to their solubility in organic solvents and enhances their reactivity. The reaction with chlorodimethylsilane introduces additional silicon-containing functionalities, which can modify the physical and chemical properties of the resulting products, such as hydrophobicity and thermal stability. These compounds are often utilized in various applications, including coatings, adhesives, and sealants, due to their ability to form durable films and their resistance to moisture. Additionally, their unique structure allows for potential use in advanced materials and nanotechnology. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with their use.
Formula:C8H20O4Si·C2H7ClSi
InChI:InChI=1S/C8H20O4Si.C2H7ClSi/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-4(2)3/h5-8H2,1-4H3;4H,1-2H3
InChI key:InChIKey=RUQUKWSXACZCKX-UHFFFAOYSA-N
SMILES:[SiH](C)(C)Cl.[Si](OCC)(OCC)(OCC)OCC
Synonyms:- Dimethylchlorosilane, ethyl silicate hydrolysis product
- Hydride q resin
- Silicic acid (H<sub>4</sub>SiO<sub>4</sub>), tetraethyl ester, reaction products with chlorodimethylsilane
- Silicic acid (H4SiO4), tetraethyl ester, reaction products with chlorodimethylsilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
