CAS 6899-04-3: Glutamine
Description:Glutamine, with the CAS number 6899-04-3, is a naturally occurring amino acid that plays a crucial role in various metabolic processes. It is classified as a non-essential amino acid, meaning that the body can synthesize it, although it can also be obtained from dietary sources, particularly protein-rich foods. Glutamine is characterized by its amine and carboxylic acid functional groups, which contribute to its solubility in water. It is a key component in protein synthesis and serves as a nitrogen donor in various biosynthetic pathways. Additionally, glutamine is vital for maintaining the health of the intestinal lining and supports immune function. It is also involved in the regulation of acid-base balance in the kidneys. In clinical settings, glutamine supplementation is often explored for its potential benefits in recovery from surgery, trauma, and certain medical conditions. Overall, glutamine is an important amino acid with diverse physiological roles, making it significant in both health and disease contexts.
Formula:C5H10N2O3
InChI:InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)
InChI key:InChIKey=ZDXPYRJPNDTMRX-UHFFFAOYSA-N
SMILES:O=C(O)C(N)CCC(=O)N
- Synonyms:
- Glutamine
- (±)-Glutamine
- DL-Gln
- γ-Glutamine
- DL-Glutamine
