CAS 6899-73-6
:Methyl (1′R,3S,4′aS,5′aS,10′aR)-1,2,5′,5′a,7′,8′,10′,10′a-octahydro-1′-methyl-2-oxospiro[3H-indole-3,6′(4′aH)-[1H]pyrano[3,4-f]indolizine]-4′-carboxylate
Description:
The chemical substance known as Methyl (1′R,3S,4′aS,5′aS,10′aR)-1,2,5′,5′a,7′,8′,10′,10′a-octahydro-1′-methyl-2-oxospiro[3H-indole-3,6′(4′aH)-[1H]pyrano[3,4-f]indolizine]-4′-carboxylate, with the CAS number 6899-73-6, is a complex organic compound characterized by its intricate molecular structure, which includes multiple fused rings and stereocenters. This compound features a spirocyclic framework, indicative of its unique three-dimensional arrangement, which can influence its biological activity and chemical reactivity. The presence of a carboxylate group suggests potential for interactions in biological systems, possibly contributing to its pharmacological properties. Additionally, the methyl and oxo functional groups may enhance its solubility and stability. Such compounds are often of interest in medicinal chemistry due to their potential therapeutic applications, particularly in the development of novel drugs. The stereochemistry of the molecule is crucial, as it can significantly affect the compound's interaction with biological targets, influencing efficacy and safety profiles.
Formula:C21H24N2O4
InChI:InChI=1S/C21H24N2O4/c1-12-14-10-23-8-7-21(16-5-3-4-6-17(16)22-20(21)25)18(23)9-13(14)15(11-27-12)19(24)26-2/h3-6,11-14,18H,7-10H2,1-2H3,(H,22,25)/t12-,13+,14-,18+,21+/m1/s1
InChI key:InChIKey=JMIAZDVHNCCPDM-DQDWJNSRSA-N
SMILES:O=C1[C@]2([C@]3(N(CC2)C[C@]4([C@](C3)(C(C(OC)=O)=CO[C@@H]4C)[H])[H])[H])C=5C(N1)=CC=CC5
Synonyms:- 7-Isoformosanine
- Formosanan-16-carboxylic acid, 19-methyl-2-oxo-, methyl ester, (7α,19β)-
- Methyl (1′R,3S,4′aS,5′aS,10′aR)-1,2,5′,5′a,7′,8′,10′,10′a-octahydro-1′-methyl-2-oxospiro[3H-indole-3,6′(4′aH)-[1H]pyrano[3,4-f]indolizine]-4′-carboxylate
- Spiro[3H-indole-3,6′(4′aH)-[1H]pyrano[3,4-f]indolizine]-4′-carboxylic acid, 1,2,5′,5′a,7′,8′,10′,10′a-octahydro-1′-methyl-2-oxo-, methyl ester, (1′R,3S,4′aS,5′aS,10′aR)-
- Uncarine A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Uncarine A
CAS:Uncarine A is a natural product from Uncaria hirsuta.Formula:C21H24N2O4Purity:98%Color and Shape:SolidMolecular weight:368.43Uncarine A
CAS:Uncarine A is an indole alkaloid, which is a bioactive compound derived from the plant species Uncaria tomentosa, commonly known as Cat's Claw. This compound is extracted from the bark and root of the plant, which is native to the Amazon rainforest and other tropical areas of Central and South America. Uncarine A acts primarily by modulating the immune response, demonstrating inhibitory effects on pro-inflammatory cytokines and NF-kB pathways. This modulation helps in reducing inflammation and potentially enhancing the body's natural defense mechanisms.Formula:C21H24N2O4Purity:Min. 95%Molecular weight:368.4 g/mol



