CAS 68990-54-5
:Glycerides, C14-22 mono-, acetates
Description:
Glycerides, C14-22 mono-, acetates, identified by CAS number 68990-54-5, are a class of chemical compounds derived from glycerol and fatty acids. These substances are esters formed by the reaction of glycerol with fatty acids that have carbon chain lengths ranging from 14 to 22, resulting in a variety of mono-acetate forms. They are typically characterized by their hydrophobic nature, which allows them to function effectively as emulsifiers, stabilizers, and surfactants in various applications, including cosmetics, food products, and pharmaceuticals. The presence of the acetate group enhances their solubility and reactivity, making them useful in formulations that require improved texture and stability. Additionally, glycerides in this category can exhibit varying degrees of viscosity and melting points depending on the specific fatty acid composition. Overall, these compounds are valued for their multifunctional properties, contributing to the performance and stability of diverse products in industrial and consumer applications.
Formula:Unspecified
InChI:InChI=1/C23H46O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26-21-23(20-24)27-22(2)25/h23-24H,3-21H2,1-2H3
SMILES:CCCCCCCCCCCCCCCCCCOCC(CO)OC(=O)C
Synonyms:- Glycerides, C14-22 mono-, acetates
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Diacetylated monoglycerides
CAS:<p>Diacetylated monoglycerides have been found to possess potent anticancer properties. They are known to inhibit the activity of various kinases, including those involved in the regulation of cell growth and apoptosis. Studies have shown that diacetylated monoglycerides can induce apoptosis in tumor cells and serve as effective inhibitors of cancer cell growth. These compounds have also been used as analogs for medicinal purposes, with potential applications in the treatment of various types of cancer. In Chinese medicine, diacetylated monoglycerides have been used as a traditional remedy for urinary tract infections and other ailments. Overall, these compounds show promise as potential therapeutic agents for the treatment of cancer and other diseases.</p>Formula:C23H46O4Purity:Min. 95%Molecular weight:386.6 g/mol
