CAS 69002-85-3
:3′-Hydroxydiclofenac
Description:
3′-Hydroxydiclofenac is a derivative of diclofenac, a widely used nonsteroidal anti-inflammatory drug (NSAID). This compound is characterized by the presence of a hydroxyl group at the 3′ position of the phenyl ring, which alters its pharmacological properties compared to its parent compound. It exhibits anti-inflammatory, analgesic, and antipyretic activities, making it relevant in the treatment of pain and inflammation. The molecular structure of 3′-Hydroxydiclofenac includes a biphenyl moiety, which contributes to its biological activity. Its solubility and stability can vary based on pH and environmental conditions, influencing its bioavailability and therapeutic efficacy. Additionally, the compound may undergo metabolic processes in the body, leading to various metabolites that can also exhibit biological activity. As with many NSAIDs, potential side effects may include gastrointestinal issues and cardiovascular risks, necessitating careful consideration in clinical use. Overall, 3′-Hydroxydiclofenac represents an important compound in pharmacology, with ongoing research into its therapeutic applications and mechanisms of action.
Formula:C14H11Cl2NO3
InChI:InChI=1S/C14H11Cl2NO3/c15-9-5-6-11(18)13(16)14(9)17-10-4-2-1-3-8(10)7-12(19)20/h1-6,17-18H,7H2,(H,19,20)
InChI key:InChIKey=HYPJZSYXUWYJDG-UHFFFAOYSA-N
SMILES:N(C1=C(CC(O)=O)C=CC=C1)C2=C(Cl)C(O)=CC=C2Cl
Synonyms:- 2-[(2,6-Dichloro-3-hydroxyphenyl)amino]benzeneacetic acid
- 3′-Hydroxydiclofenac
- Benzeneacetic Acid, 2-[(2,6-Dichloro-3-Hydroxyphenyl)Amino]-
- [2-(2,6-Dichloro-3-hydroxyanilino)phenyl]acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3’-Hydroxy Diclofenac-d4
CAS:Controlled ProductFormula:C14D4H7Cl2NO3Color and Shape:NeatMolecular weight:316.1733’-Hydroxy Diclofenac
CAS:Controlled ProductFormula:C14H11Cl2NO3Color and Shape:NeatMolecular weight:312.1483'-Hydroxydiclofenac
CAS:3'-Hydroxydiclofenac is a dichlorinated derivative of the nonsteroidal anti-inflammatory drug diclofenac. 3'-Hydroxydiclofenac inhibits the production of cytokines that are responsible for inflammation, and it has been shown to be effective in reducing pain and inflammation in patients with chronic hepatitis. In vitro tests have shown that 3'-hydroxydiclofenac does not have carcinogenic potential, but its safety profile has not been determined. 3'-Hydroxydiclofenac is metabolized by humans into monohydroxylated metabolites, which can be detected in urine samples. The metabolism of 3'-hydroxydiclofenac is similar to that of other drugs that are metabolized by humans into monohydroxylated metabolites.
Formula:C14H11Cl2NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:312.15 g/molRef: 3D-FH71816
Discontinued product





