CAS 69026-14-8
:3-(benzyloxy)benzoic acid
Description:
3-(Benzyloxy)benzoic acid, with the CAS number 69026-14-8, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a benzyloxy group at the meta position. This compound typically exhibits properties common to aromatic carboxylic acids, such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic rings. The presence of the carboxylic acid functional group contributes to its acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the benzyloxy substituent can influence the compound's reactivity and stability, potentially enhancing its lipophilicity. 3-(Benzyloxy)benzoic acid may also exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its structural features suggest potential applications in organic synthesis and as a building block for more complex molecules. Overall, this compound is notable for its unique combination of functional groups and its relevance in various chemical contexts.
Formula:C14H12O3
InChI:InChI=1/C14H12O3/c15-14(16)12-7-4-8-13(9-12)17-10-11-5-2-1-3-6-11/h1-9H,10H2,(H,15,16)
SMILES:c1ccc(cc1)COc1cccc(c1)C(=O)O
Synonyms:- Benzoic Acid, 3-(Phenylmethoxy)-
- 3-(Benzyloxy)Benzoate
- 3-Benzyloxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Benzyloxybenzoic acid, 98%
CAS:3-Benzyloxybenzoic acid is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referenFormula:C14H12O3Purity:98%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:228.253-(benzyloxy)benzoic acid
CAS:Formula:C14H12O3Purity:98%Color and Shape:SolidMolecular weight:228.247



