CAS 690261-89-3

Piperidine, 4-(2H-1,2,3-triazol-2-yl)-, hydrochloride (1:1)

Description:

Piperidine, 4-(2H-1,2,3-triazol-2-yl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 1,2,3-triazole moiety introduces additional nitrogen atoms and contributes to the compound's potential biological activity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in laboratory settings. It is often used in medicinal chemistry and drug development due to its structural features that may exhibit pharmacological properties. The compound's molecular structure allows for various interactions with biological targets, making it of interest in the synthesis of pharmaceuticals. As with many nitrogen-containing heterocycles, it may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological activities would depend on further empirical studies. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological effects.

Formula: C₇H₁₂N₄·ClH

InChI: InChI=1S/C7H12N4.ClH/c1-3-8-4-2-7(1)11-9-5-6-10-11;/h5-8H,1-4H2;1H

InChI key: InChIKey=XVDANFKKMZPMOU-UHFFFAOYSA-N

SMILES: N1(N=CC=N1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-(2H-1,2,3-triazol-2-yl)-, monohydrochloride
• Piperidine,4-(2H-1,2,3-triazol-2-yl)-, monohydrochloride (9CI)
• Piperidine, 4-(2H-1,2,3-triazol-2-yl)-, hydrochloride (1:1)

4-(2H-1,2,3-triazol-2-yl)piperidine hydrochloride

CAS: 690261-89-3

Purity: 98%

Molecular weight: 188.6600037

Ref: 10-F775499

4-[1,2,3]Triazol-2-yl-piperidine hydrochloride

CAS: 690261-89-3

Versatile small molecule scaffold

Formula: C₇H₁₃ClN₄

Purity: Min. 95%

Molecular weight: 188.66 g/mol

Ref: 3D-QCB26189