CAS 690270-29-2

Balapiravir

Description:

Balapiravir, with the CAS number 690270-29-2, is an antiviral compound that has been investigated primarily for its potential use in treating viral infections, including those caused by RNA viruses. It belongs to the class of nucleoside analogs, which function by interfering with viral replication. Balapiravir exhibits characteristics typical of nucleoside analogs, such as the ability to mimic natural nucleotides, thereby disrupting the viral RNA synthesis process. Its mechanism of action involves incorporation into the viral RNA, leading to premature termination of the RNA chain. The compound has shown promise in preclinical studies and clinical trials, particularly in the context of treating infections like hepatitis C and potentially other viral diseases. Balapiravir's pharmacokinetic properties, including absorption, distribution, metabolism, and excretion, are crucial for determining its efficacy and safety profile. As research continues, further insights into its therapeutic potential and any associated side effects will be essential for its development as a viable antiviral treatment.

Formula: C₂₁H₃₀N₆O₈

InChI: InChI=1S/C21H30N6O8/c1-10(2)17(28)32-9-21(25-26-23)15(34-19(30)12(5)6)14(33-18(29)11(3)4)16(35-21)27-8-7-13(22)24-20(27)31/h7-8,10-12,14-16H,9H2,1-6H3,(H2,22,24,31)/t14-,15+,16-,21-/m1/s1

InChI key: InChIKey=VKXWOLCNTHXCLF-DXEZIKHYSA-N

SMILES: C(OC(C(C)C)=O)[C@]1(N=[N+]=[N-])[C@@H](OC(C(C)C)=O)[C@@H](OC(C(C)C)=O)[C@@H](O1)N2C(=O)N=C(N)C=C2

Synonyms:

• Balapiravir
• Ro 4588161
• Cytidine, 4′-C-azido-, 2′,3′,5′-tris(2-methylpropanoate)
• R 1626

Balapiravir

CAS: 690270-29-2

Balapiravir (R1626) is a prodrug targeting HCV polymerase, discontinued due to safety concerns like lymphopenia and other serious side effects.

Formula: C₂₁H₃₀N₆O₈

Color and Shape: Solid

Molecular weight: 494.5

Ref: TM-T14493

Balapiravir

CAS: 690270-29-2

Balapiravir is an antiviral agent, which is a synthetic derivative based on natural compounds, specifically designed to inhibit the replication of various viral pathogens. The source of Balapiravir integrates bio-based elements with modifications to enhance its therapeutic efficacy.

Formula: C₂₁H₃₀N₆O₈

Purity: Min. 95%

Molecular weight: 494.5 g/mol

Ref: 3D-FB153416