CAS 6903-07-7
:Grifolin
Description:
Grifolin, with the CAS number 6903-07-7, is a naturally occurring compound primarily derived from certain species of fungi, particularly those in the genus *Grifola*. It is classified as a sesquiterpene, which is a type of terpene composed of three isoprene units, resulting in a complex structure that contributes to its biological activity. Grifolin has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and antimicrobial effects. The compound exhibits a unique chemical structure that allows it to interact with various biological targets, making it a subject of research for its therapeutic applications. Additionally, Grifolin's solubility characteristics and stability under different conditions are important for its use in formulations. As with many natural products, the extraction and purification processes can influence its availability and efficacy. Overall, Grifolin represents a fascinating area of study within natural product chemistry and its potential uses in medicine.
Formula:C22H32O2
InChI:InChI=1S/C22H32O2/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-20-21(23)14-19(5)15-22(20)24/h8,10,12,14-15,23-24H,6-7,9,11,13H2,1-5H3/b17-10+,18-12+
InChI key:InChIKey=PZHNKNRPGLTZPO-VZRGJMDUSA-N
SMILES:C(/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)C1=C(O)C=C(C)C=C1O
Synonyms:- 1,3-Benzenediol, 5-methyl-2-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrienyl]-
- 1,3-Benzenediol,5-methyl-2-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-
- 1,3-Benzenediol,5-methyl-2-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrienyl]- (9CI)
- 5-Methyl-2-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-1,3-benzenediol
- Grifolin
- Grifolin(7CI)
- Resorcinol, 5-methyl-2-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-
- Resorcinol, 5-methyl-2-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-(8CI)
- 1,3-Benzenediol, 5-methyl-2-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Grifolin
CAS:<p>Grifolin fights cancer, aids OPCs, has antimicrobial/antifungal properties, counters leishmania, and lowers cholesterol in rats.</p>Formula:C22H32O2Purity:98%Color and Shape:SolidMolecular weight:328.49Grifolin
CAS:Controlled Product<p>Applications Grifolin is an intermediate in the synthesis of Grifolic Acid (G786500), which is a selective partial GPR120 agonist. Grifolic Acid induces ERK and [Ca2+]i responses in cells expressing GPR120, but has no effects on those expressing GPR40.<br>References Hara, T. et al.: Naun. Schmied. Arch. Pharmacol., 380, 247 (2009); Sun. Q. et al.: Mol. Pharmacol., 78, 804 (2010);<br></p>Formula:C22H32O2Color and Shape:NeatMolecular weight:328.49Grifolin
CAS:<p>Grifolin is a bioactive compound, which is a natural metabolite derived from the mushroom Albatrellus confluens. It is identified as a fungal secondary metabolite with significant biological activities. Its mode of action involves modulating various cellular pathways, particularly those related to apoptosis and cell cycle regulation. Grifolin exerts its effects through the inhibition of certain enzymes and signaling proteins, leading to altered cellular outcomes.</p>Formula:C22H32O2Purity:Min. 95%Molecular weight:328.49 g/mol


