CAS 69033-88-1

4-[(5-Bromo-2-pyrimidinyl)oxy]phenol

Description:

4-[(5-Bromo-2-pyrimidinyl)oxy]phenol, with the CAS number 69033-88-1, is an organic compound characterized by its phenolic structure, which includes a brominated pyrimidine moiety. This compound typically appears as a solid and is soluble in organic solvents, reflecting its polar functional groups. The presence of the bromine atom enhances its reactivity, making it useful in various chemical syntheses and applications, particularly in medicinal chemistry and agrochemicals. The phenolic hydroxyl group contributes to its potential as an antioxidant and may influence its biological activity. Additionally, the compound's structure suggests it may participate in hydrogen bonding, affecting its solubility and interaction with biological targets. Its unique combination of functional groups allows for diverse applications, including as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4-[(5-Bromo-2-pyrimidinyl)oxy]phenol is a versatile compound with significant implications in research and industry.

Formula: C₁₀H₇BrN₂O₂

InChI: InChI=1S/C10H7BrN2O2/c11-7-5-12-10(13-6-7)15-9-3-1-8(14)2-4-9/h1-6,14H

InChI key: InChIKey=PMONOVBATWRDGV-UHFFFAOYSA-N

SMILES: O(C1=CC=C(O)C=C1)C=2N=CC(Br)=CN2

Synonyms:

• Phenol, 4-[(5-bromo-2-pyrimidinyl)oxy]-
• 4-[(5-Bromo-2-pyrimidinyl)oxy]phenol

4-[(5-Bromopyrimidin-2-yl)oxy]phenol

CAS: 69033-88-1

Versatile small molecule scaffold

Formula: C₁₀H₇BrN₂O₂

Purity: Min. 95%

Molecular weight: 267.08 g/mol

Ref: 3D-UCA03388