CAS 69038-81-9
:3-(2-Ethoxyphenyl)-2-propenoic acid
Description:
3-(2-Ethoxyphenyl)-2-propenoic acid, identified by its CAS number 69038-81-9, is an organic compound characterized by its propenoic acid structure, which features a double bond between the second and third carbon atoms of the propene chain. This compound contains an ethoxy group attached to a phenyl ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the ethoxy group enhances its solubility in organic solvents, while the carboxylic acid functional group provides acidic properties. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its reactivity is influenced by the conjugated double bond, allowing for potential polymerization or reaction with nucleophiles. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, 3-(2-Ethoxyphenyl)-2-propenoic acid is a versatile compound with applications in various chemical syntheses and research fields.
Formula:C11H12O3
InChI:InChI=1S/C11H12O3/c1-2-14-10-6-4-3-5-9(10)7-8-11(12)13/h3-8H,2H2,1H3,(H,12,13)
InChI key:InChIKey=UXTDCJJEJZCEBF-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=C(OCC)C=CC=C1
Synonyms:- (2E)-3-(2-ethoxyphenyl)prop-2-enoic acid
- 2-Propenoic acid, 3-(2-ethoxyphenyl)-
- 3-(2-Ethoxyphenyl)-2-propenoic acid
- Cinnamic acid, o-ethoxy-
- NSC 98551
- 2-Ethoxycinnamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(2-ethoxyphenyl)prop-2-enoic acid
CAS:Formula:C11H12O3Purity:97%Color and Shape:SolidMolecular weight:192.21122-Ethoxycinnamic acid
CAS:2-Ethoxycinnamic acidFormula:C11H12O3Purity:97%Color and Shape: white to off-white solidMolecular weight:192.21g/mol2-Ethoxycinnamic acid
CAS:2-Ethoxycinnamic acid is a metastable molecule that has been obtained by an asymmetric synthesis. It is unreactive, and its reaction products are polyvalent. 2-Ethoxycinnamic acid can be analyzed using analytical methods such as flow system, functional theory, and gas chromatography. 2-Ethoxycinnamic acid has been used in the preparation of cinnamates, which are used in perfumes and flavors. Polymorphs of this molecule have also been observed in crystalline form. There are two different forms of the molecule: α-form and β-form. The α-form is more stable than the β-form because it has a hydrogen bond with the methyl group on the left side of the molecule.
Formula:C11H12O3Purity:Min. 95%Color and Shape:PowderMolecular weight:192.21 g/mol2-Ethoxycinnamic acid, 98+%
CAS:Formula:C11H12O3Purity:99.0%Color and Shape:SolidMolecular weight:192.214




