
CAS 69047-39-8
:Binifibrate
Description:
Binifibrate is a chemical compound classified as a fibrate, primarily used for its lipid-lowering properties. It is known to activate peroxisome proliferator-activated receptors (PPARs), which play a crucial role in the regulation of fatty acid metabolism and glucose homeostasis. Binifibrate is characterized by its ability to reduce triglyceride levels and increase high-density lipoprotein (HDL) cholesterol, making it beneficial in managing dyslipidemia. The compound is typically administered in oral form and is often prescribed in conjunction with dietary modifications to enhance its efficacy. Its pharmacokinetics involve absorption in the gastrointestinal tract, followed by metabolism in the liver, and it is excreted primarily through the kidneys. Binifibrate is generally well-tolerated, although potential side effects may include gastrointestinal disturbances and muscle-related issues. As with any medication, it is essential for patients to consult healthcare professionals for personalized advice and monitoring while using Binifibrate, especially considering its interactions with other lipid-modifying therapies.
Formula:C25H23ClN2O7
InChI:InChI=1S/C25H23ClN2O7/c1-25(2,35-20-9-7-19(26)8-10-20)24(31)34-21(15-32-22(29)17-5-3-11-27-13-17)16-33-23(30)18-6-4-12-28-14-18/h3-14,21H,15-16H2,1-2H3
InChI key:InChIKey=BFYRHDVAEJIBON-UHFFFAOYSA-N
SMILES:C(OC(C(OC1=CC=C(Cl)C=C1)(C)C)=O)(COC(=O)C=2C=CC=NC2)COC(=O)C=3C=CC=NC3
Synonyms:- Binifibrate
- 3-Pyridinecarboxylic acid, 2-[2-(4-chlorophenoxy)-2-methyl-1-oxopropoxy]-1,3-propanediyl ester
- WAC 104
- Biniwas
- 3-Pyridinecarboxylic acid, 3,3′-[2-[2-(4-chlorophenoxy)-2-methyl-1-oxopropoxy]-1,3-propanediyl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Binifibrate
CAS:<p>Binifibrate is a hyperlipemiant drug used for the treatment of hyperlipidemia.</p>Formula:C25H23ClN2O7Color and Shape:SolidMolecular weight:498.91
