CAS 6905-47-1

6-methoxypyrazin-2-amine

Description:

6-Methoxypyrazin-2-amine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 4 positions. The presence of a methoxy group (-OCH3) at the 6-position and an amino group (-NH2) at the 2-position contributes to its chemical reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the functional groups present. As with many nitrogen-containing heterocycles, it may exhibit unique electronic properties, influencing its behavior in chemical reactions and interactions with biological systems. Safety data and handling precautions should be considered, as with any chemical substance.

Formula: C₅H₇N₃O

InChI: InChI=1/C5H7N3O/c1-9-5-3-7-2-4(6)8-5/h2-3H,1H3,(H2,6,8)

SMILES: COc1cncc(N)n1

Synonyms:

• 2-Pyrazinamine, 6-methoxy-
• 6-Methoxypyrazinamine

2-Amino-6-methoxypyrazine

CAS: 6905-47-1

Formula: C₅H₇N₃O

Purity: 98%

Color and Shape: Solid

Molecular weight: 125.1286

Ref: IN-DA003N9Y

2-Amino-6-methoxypyrazine

CAS: 6905-47-1

2-Amino-6-methoxypyrazine

Formula: C₅H₇N₃O

Purity: 96%

Color and Shape: beige solid

Molecular weight: 125.13g/mol

Ref: 54-OR301157

2-Amino-6-methoxypyrazine

CAS: 6905-47-1

Formula: C₅H₇N₃O

Purity: 96%

Color and Shape: Solid

Molecular weight: 125.131

Ref: 10-F076105