CAS 69056-67-3
:4,4,4-Trifluoro-3-methyl-2-butenoic acid
Description:
4,4,4-Trifluoro-3-methyl-2-butenoic acid is a fluorinated organic compound characterized by the presence of three fluorine atoms, a methyl group, and a carboxylic acid functional group. This compound features a double bond in its butenoic acid structure, contributing to its reactivity and potential applications in organic synthesis. The trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical chemistry. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the compound's unique structure may lead to distinctive physical properties, such as altered boiling and melting points compared to non-fluorinated analogs. Its CAS number, 69056-67-3, allows for easy identification in chemical databases and literature. Overall, 4,4,4-Trifluoro-3-methyl-2-butenoic acid is a valuable compound in the field of synthetic organic chemistry and materials science.
Formula:C5H5F3O2
InChI:InChI=1S/C5H5F3O2/c1-3(2-4(9)10)5(6,7)8/h2H,1H3,(H,9,10)
InChI key:InChIKey=QRRCTLYMABZQCS-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)(C(F)(F)F)C
Synonyms:- (2E)-4,4,4-trifluoro-3-methylbut-2-enoic acid
- (2Z)-4,4,4-trifluoro-3-methylbut-2-enoic acid
- 2-Butenoic acid, 4,4,4-trifluoro-3-methyl-
- 4,4,4-Trifluoro-3-methyl-2-butenoic acid
- Crotonic acid, 4,4,4-trifluoro-3-methyl-
- β-(Trifluoromethyl)crotonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(Trifluoromethyl)crotonic acid, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H5F3O2Purity:96%Color and Shape:White to pale yellow or clear colorless to pale yellow, Crystals or powder or crystalline powder or fused solid or liquid as meltMolecular weight:154.093-(Trifluoromethyl)crotonic acid
CAS:3-(Trifluoromethyl)crotonic acidFormula:C5H5F3O2Purity:95%Color and Shape: white crystalline powderMolecular weight:154.09g/mol3-(Trifluoromethyl)Crotonic Acid
CAS:<p>3-(Trifluoromethyl)crotonic acid is a colorless liquid that has been used as an additive in the production of cinchonidine, a drug for the treatment of high blood pressure. 3-(Trifluoromethyl)crotonic acid is also a monomer that reacts with phosphorus pentoxide to form crotonaldehyde. The crotonaldehyde can react with ethanolamine or ammonia to form (trifluoromethyl)crotonamide or (trifluoromethyl)cinnamamide respectively. It is also used as a nucleophile in chemical reactions and as a solvent in voltammetry experiments. 3-(Trifluoromethyl)crotonic acid has hydrophobic properties and can be found in nature as α-tocopherol. It is also known to have antibacterial properties due to its chloride group.</p>Formula:C5H5F3O2Purity:Min. 95%Molecular weight:154.09 g/mol



