CAS 69061-17-2

N-[(2-Chlorophenyl)methyl]-2-thiopheneethanamine

Description:

N-[(2-Chlorophenyl)methyl]-2-thiopheneethanamine, identified by its CAS number 69061-17-2, is an organic compound characterized by its unique structure that includes a thiophene ring and a chlorophenyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the thiophene moiety contributes to its potential for aromaticity and may influence its reactivity and solubility in various solvents. The chlorophenyl group can enhance lipophilicity, which may affect the compound's biological activity and interaction with biological systems. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would depend on the functional groups present. Overall, N-[(2-Chlorophenyl)methyl]-2-thiopheneethanamine represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₃H₁₄ClNS

InChI: InChI=1S/C13H14ClNS/c14-13-6-2-1-4-11(13)10-15-8-7-12-5-3-9-16-12/h1-6,9,15H,7-8,10H2

InChI key: InChIKey=KEOKHDKWKYGPGO-UHFFFAOYSA-N

SMILES: C(NCCC1=CC=CS1)C2=C(Cl)C=CC=C2

Synonyms:

• 2-Thiopheneethanamine, N-[(2-chlorophenyl)methyl]-
• N-(2-chlorobenzyl)-2-(thiophen-3-yl)ethanamine
• N-[(2-Chlorophenyl)methyl]-2-thiopheneethanamine
• [(2-Chlorophenyl)methyl][2-(thiophen-2-yl)ethyl]amine

Ticlopidine EP Impurity I

CAS: 69061-17-2

Formula: C₁₃H₁₄ClNS

Molecular weight: 251.77

Ref: ST-EA-CP-T45009