CAS 690619-43-3
:pyrimidine-5-carboxamidine
Description:
Pyrimidine-5-carboxamidine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. This compound features a carboxamidine functional group, which consists of a carbonyl group (C=O) bonded to an amine (NH2) at the 5-position of the pyrimidine ring. Pyrimidine-5-carboxamidine is typically a white to off-white solid and is soluble in polar solvents, reflecting its polar functional groups. It is of interest in various fields, including medicinal chemistry, due to its potential biological activity and role as a building block in the synthesis of pharmaceuticals. The compound may exhibit properties such as antimicrobial or antiviral activity, making it a subject of research in drug development. Additionally, its structure allows for various chemical modifications, which can enhance its biological properties or alter its solubility and stability. As with many nitrogen-containing heterocycles, it may also participate in hydrogen bonding, influencing its interactions in biological systems.
Formula:C5H6N4
InChI:InChI=1/C5H6N4/c6-5(7)4-1-8-3-9-2-4/h1-3H,(H3,6,7)
SMILES:c1c(cncn1)C(=N)N
Synonyms:- 5-Pyrimidinecarboximidamide
- Pyrimidine-5-carboximidamide
- Pyrimidine-5-carboxamidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyrimidine-5-carboxamidine; hydrochloride
CAS:Formula:C5H7ClN4Purity:95.0%Color and Shape:SolidMolecular weight:158.59Pyrimidine-5-carboxamidine hydrochloride
CAS:Pyrimidine-5-carboxamidine hydrochloride
Molecular weight:158.59g/molPyrimidine-5-carboxamidine hydrochloride
CAS:Pyrimidine-5-carboxamidine hydrochloride (GC) is a guanosine analog that inhibits bacterial growth by binding to the anticodon region of ribosomes. GC has been shown to bind to the replicons of many organisms, including bacteria, and inhibit the formation of mRNA from DNA. This drug also inhibits methyltransferase, which prevents transfer RNA from being modified with methionine. GC may be used in research for eukaryotes and deamination reactions in trna modification.Formula:C5H6N4·HClPurity:Min. 95%Molecular weight:158.59 g/mol



