CymitQuimica logo

CAS 690631-99-3

:

(6-piperidin-1-ylpyridin-3-yl)methanol

Description:
(6-Piperidin-1-ylpyridin-3-yl)methanol, with the CAS number 690631-99-3, is a chemical compound characterized by its unique structure that includes a piperidine ring and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic amines and alcohols, which may influence its solubility and reactivity. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry due to its ability to interact with biological targets. The presence of the hydroxymethyl group suggests it may participate in hydrogen bonding, enhancing its interactions in biological systems. Additionally, the piperidine and pyridine rings contribute to its basicity and potential as a ligand in coordination chemistry. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, (6-piperidin-1-ylpyridin-3-yl)methanol represents a versatile scaffold for further chemical exploration and development in various fields, including pharmaceuticals.
Formula:C11H16N2O
InChI:InChI=1/C11H16N2O/c14-9-10-4-5-11(12-8-10)13-6-2-1-3-7-13/h4-5,8,14H,1-3,6-7,9H2
SMILES:C1CCN(CC1)c1ccc(cn1)CO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.