CAS 690632-04-3
:2-(2,3-Dihydro-5-benzofuranyl)-5-methyl-4-thiazolecarboxylic acid
Description:
2-(2,3-Dihydro-5-benzofuranyl)-5-methyl-4-thiazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a benzofuran moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the thiazole and benzofuran groups may contribute to its reactivity and interaction with biological targets, suggesting potential applications in medicinal chemistry. Additionally, the carboxylic acid functional group can influence its acidity and polarity, affecting its behavior in various chemical environments. The compound's molecular structure may also allow for various synthetic modifications, which can be explored for enhancing its efficacy or altering its pharmacokinetic properties. Overall, 2-(2,3-Dihydro-5-benzofuranyl)-5-methyl-4-thiazolecarboxylic acid represents a complex organic molecule with potential implications in drug development and chemical research.
Formula:C13H11NO3S
InChI:InChI=1S/C13H11NO3S/c1-7-11(13(15)16)14-12(18-7)9-2-3-10-8(6-9)4-5-17-10/h2-3,6H,4-5H2,1H3,(H,15,16)
InChI key:InChIKey=MAMXNIJKFSPVLJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C(SC1C)C=2C=C3C(=CC2)OCC3
Synonyms:- 2-(2,3-Dihydro-5-benzofuranyl)-5-methyl-4-thiazolecarboxylic acid
- 2-(2,3-Dihydro-1-benzofuran-5-yl)-5-methyl-1,3-thiazole-4-carboxylic acid
- 4-Thiazolecarboxylic acid, 2-(2,3-dihydro-5-benzofuranyl)-5-methyl-
- 2-(2,3-Dihydrobenzofuran-5-yl)-5-methylthiazole-4-carboxylic acid
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery