CAS 690632-39-4

2-pyrrolidin-1-ylpyridine-3-carbaldehyde

Description:

2-Pyrrolidin-1-ylpyridine-3-carbaldehyde, with the CAS number 690632-39-4, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a pyrrolidine moiety. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. Its molecular structure includes an aldehyde functional group, which contributes to its reactivity, particularly in condensation reactions and as a potential electrophile in various organic syntheses. The presence of both the pyridine and pyrrolidine rings suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their biological activity. Additionally, the compound may exhibit properties such as moderate to high stability under standard conditions, although it should be handled with care due to the reactivity associated with the aldehyde group. Overall, 2-pyrrolidin-1-ylpyridine-3-carbaldehyde is of interest in synthetic organic chemistry and drug discovery.

Formula: C₁₀H₁₂N₂O

InChI: InChI=1/C10H12N2O/c13-8-9-4-3-5-11-10(9)12-6-1-2-7-12/h3-5,8H,1-2,6-7H2

SMILES: C1CCN(C1)c1c(cccn1)C=O

Synonyms:

• 2-(1-Pyrrolidinyl)Nicotinaldehyde

3-Pyridinecarboxaldehyde,2-(1-pyrrolidinyl)-

CAS: 690632-39-4

Formula: C₁₀H₁₂N₂O

Purity: 97%

Molecular weight: 176.2151

Ref: IN-DA005LRT

2-(Pyrrolidin-1-yl)nicotinaldehyde

CAS: 690632-39-4

2-(Pyrrolidin-1-yl)nicotinaldehyde

Purity: 97%

Molecular weight: 176.22g/mol

Ref: 54-OR75513

2-(Pyrrolidin-1-yl)nicotinaldehyde

CAS: 690632-39-4

Purity: 97%

Molecular weight: 176.2189941

Ref: 10-F680724