CAS 690634-81-2

2-(pyrrolidin-1-ylcarbonyl)piperidine hydrochloride

Description:

2-(Pyrrolidin-1-ylcarbonyl)piperidine hydrochloride is a chemical compound characterized by its unique structural features, which include a piperidine ring and a pyrrolidine moiety linked through a carbonyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for various applications in medicinal chemistry and pharmacology. The presence of both piperidine and pyrrolidine rings suggests potential biological activity, particularly in the context of drug design, where such structures can influence receptor interactions and pharmacokinetics. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Overall, 2-(pyrrolidin-1-ylcarbonyl)piperidine hydrochloride is of interest in research settings, particularly in the development of therapeutic agents targeting neurological or psychiatric disorders.

Formula: C₁₀H₁₉ClN₂O

InChI: InChI=1/C10H18N2O.ClH/c13-10(12-7-3-4-8-12)9-5-1-2-6-11-9;/h9,11H,1-8H2;1H

SMILES: C1CCNC(C1)C(=O)N1CCCC1.Cl

Synonyms:

• 2-Piperidinyl(1-Pyrrolidinyl)Methanone Hydrochloride

(2-Piperidinyl)(1-pyrrolidinyl)methanone hydrochloride

CAS: 690634-81-2

Versatile small molecule scaffold

Formula: C₁₀H₁₈N₂O·HCl

Purity: Min. 95%

Molecular weight: 218.73 g/mol

Ref: 3D-QCB63481