CymitQuimica logo

CAS 690635-73-5

:

2-Bromo-3-methylthieno[3,2-c]pyridin-4(5H)-one

Description:
2-Bromo-3-methylthieno[3,2-c]pyridin-4(5H)-one is a heterocyclic organic compound characterized by its unique structure, which includes a thieno-pyridine framework. This compound features a bromine atom at the 2-position and a methyl group at the 3-position of the thieno ring, contributing to its chemical reactivity and potential biological activity. The presence of the carbonyl group in the pyridinone structure enhances its ability to participate in various chemical reactions, such as nucleophilic attacks and condensation reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its specific properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. 2-Bromo-3-methylthieno[3,2-c]pyridin-4(5H)-one is of interest in medicinal chemistry and may have applications in drug development, particularly due to its potential pharmacological properties. As with many heterocycles, it may also serve as a building block for synthesizing more complex molecules.
Formula:C8H6BrNOS
InChI:InChI=1S/C8H6BrNOS/c1-4-6-5(12-7(4)9)2-3-10-8(6)11/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=GYXMWPUFAAQXIF-UHFFFAOYSA-N
SMILES:CC=1C2=C(SC1Br)C=CNC2=O
Synonyms:
  • 2-Bromo-3-methylthieno[3,2-c]pyridin-4(5H)-one
  • 2-Bromo-3-methyl-5H-thieno[3,2-c]pyridin-4-one
  • Thieno[3,2-c]pyridin-4(5H)-one, 2-bromo-3-methyl-
  • 2-Bromo-3-methyl-4H,5H-thieno[3,2-c]pyridin-4-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.