CAS 690645-98-8

4-[[[(3-Chlorophenyl)sulfonyl]amino]methyl]benzoic acid

Description:

4-[[[(3-Chlorophenyl)sulfonyl]amino]methyl]benzoic acid, identified by its CAS number 690645-98-8, is a chemical compound characterized by its sulfonamide functional group, which contributes to its potential biological activity. This compound features a benzoic acid moiety, indicating it has acidic properties, and a chlorophenyl group that may influence its lipophilicity and reactivity. The presence of the sulfonyl group enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry. Its structural complexity suggests potential interactions with biological targets, which may be of interest in drug development. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic rings, which may affect its pharmacokinetic properties. Overall, 4-[[[(3-Chlorophenyl)sulfonyl]amino]methyl]benzoic acid represents a class of compounds that may exhibit significant therapeutic potential, warranting further investigation into its biological effects and mechanisms of action.

Formula: C₁₄H₁₂ClNO₄S

InChI: InChI=1S/C14H12ClNO4S/c15-12-2-1-3-13(8-12)21(19,20)16-9-10-4-6-11(7-5-10)14(17)18/h1-8,16H,9H2,(H,17,18)

InChI key: InChIKey=CTNSYQWHQNQSIT-UHFFFAOYSA-N

SMILES: S(NCC1=CC=C(C(O)=O)C=C1)(=O)(=O)C2=CC(Cl)=CC=C2

Synonyms:

• Benzoic acid, 4-[[[(3-chlorophenyl)sulfonyl]amino]methyl]-
• 4-[[[(3-Chlorophenyl)sulfonyl]amino]methyl]benzoic acid
• 4-(((3-Chlorophenyl)sulfonamido)methyl)benzoic acid

4-(((3-chlorophenyl)sulfonamido)methyl)benzoic acid

CAS: 690645-98-8

Formula: C₁₄H₁₂ClNO₄S

Purity: 95.0%

Molecular weight: 325.76

Ref: 10-F496362

4-(([(3-Chlorophenyl)sulfonyl]amino)methyl)benzoic acid

CAS: 690645-98-8

Versatile small molecule scaffold

Formula: C₁₄H₁₂ClNO₄S

Purity: Min. 95%

Molecular weight: 325.8 g/mol

Ref: 3D-QCB64598