CAS 69079-26-1

1-benzyl-2-methylpyrrolidin-3-one

Description:

1-Benzyl-2-methylpyrrolidin-3-one, with the CAS number 69079-26-1, is a chemical compound characterized by its pyrrolidine structure, which includes a five-membered ring containing nitrogen. This compound features a benzyl group and a methyl group attached to the pyrrolidine ring, contributing to its unique properties. It is typically a white to off-white solid and is soluble in organic solvents, which makes it useful in various chemical applications. The presence of the carbonyl group (ketone) at the 3-position of the pyrrolidine ring is significant, as it can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit psychoactive properties and has been studied for its potential applications in medicinal chemistry. However, due to its structural characteristics, it is essential to handle it with care, following appropriate safety protocols. As with many organic compounds, its reactivity and stability can be influenced by environmental factors such as temperature and pH.

Formula: C₁₂H₁₅NO

InChI: InChI=1/C12H15NO/c1-10-12(14)7-8-13(10)9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3

SMILES: CC1C(=O)CCN1Cc1ccccc1

1-Benzyl-2-methyl-3-pyrrolidone

Controlled Product

CAS: 69079-26-1

Applications 1-Benzyl-2-methyl-3-pyrrolidone (cas# 69079-26-1) is a compound useful in organic synthesis.
References Iwanami, S., et al.: J. Med. Chem., 24, 1224 (1981),

Formula: C₁₂H₁₅NO

Color and Shape: Neat

Molecular weight: 189.25

Ref: TR-B285705