CymitQuimica logo

CAS 69081-83-0

:

1-ethylpiperidine-2-carboxylic acid

Description:
1-Ethylpiperidine-2-carboxylic acid is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an ethyl group attached to the nitrogen atom of the piperidine ring and a carboxylic acid functional group (-COOH) at the second position of the ring. The presence of the carboxylic acid group imparts acidic properties to the molecule, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the ethyl substituent contributes to the compound's hydrophobic character, influencing its solubility in organic solvents. 1-Ethylpiperidine-2-carboxylic acid may exhibit biological activity, making it of interest in pharmaceutical research and development. Its structural features suggest potential applications in medicinal chemistry, particularly in the design of compounds targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C8H15NO2
InChI:InChI=1/C8H15NO2/c1-2-9-6-4-3-5-7(9)8(10)11/h7H,2-6H2,1H3,(H,10,11)
SMILES:CCN1CCCCC1C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.