CAS 69083-54-1

5-Ethyl-3-methyl-4-isoxazolecarboxylic acid

Description:

5-Ethyl-3-methyl-4-isoxazolecarboxylic acid is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features an ethyl group and a methyl group attached to the isoxazole ring, contributing to its unique properties. It is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids due to their ability to form hydrogen bonds. The presence of the carboxylic acid functional group (-COOH) indicates that it can act as an acid, donating protons in solution. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific applications and reactivity can vary based on the functional groups present and the overall molecular structure. As with many organic compounds, safety data should be consulted for handling and storage, as it may pose health risks if ingested or inhaled.

Formula: C₇H₉NO₃

InChI: InChI=1S/C7H9NO3/c1-3-5-6(7(9)10)4(2)8-11-5/h3H2,1-2H3,(H,9,10)

InChI key: InChIKey=QEBFYEKSQILKOY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(CC)ON=C1C

Synonyms:

• 3-Methyl-5-ethylisoxazole-4-carboxylic acid
• 5-Ethyl-3-methyl-4-isoxazolecarboxylic acid
• 4-Isoxazolecarboxylic acid, 5-ethyl-3-methyl-

5-Ethyl-3-methyl-isoxazole-4-carboxylic acid

CAS: 69083-54-1

Versatile small molecule scaffold

Formula: C₇H₉NO₃

Purity: Min. 95%

Molecular weight: 155.15 g/mol

Ref: 3D-UCA08354