CAS 69091-17-4

(1S)-1-(5,8-dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-en-1-yl 3-(acetyloxy)-3-methylbutanoate

Description:

The chemical substance with the name "(1S)-1-(5,8-dihydroxy-1,4-dioxo-1,4-dihydronaphthalen-2-yl)-4-methylpent-3-en-1-yl 3-(acetyloxy)-3-methylbutanoate" and CAS number 69091-17-4 is a complex organic compound characterized by its unique structural features. It contains a naphthalene derivative with multiple hydroxyl and carbonyl functional groups, indicating potential for hydrogen bonding and reactivity. The presence of an acetyloxy group suggests that it may exhibit ester-like properties, which can influence its solubility and reactivity in various chemical environments. The compound's stereochemistry, indicated by the (1S) configuration, implies specific spatial arrangements that can affect its biological activity and interactions with other molecules. Additionally, the presence of a pentene moiety suggests potential for further chemical transformations, such as polymerization or addition reactions. Overall, this compound may have applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation.

Formula: C₂₃H₂₆O₈

InChI: InChI=1/C23H26O8/c1-12(2)6-9-18(30-19(28)11-23(4,5)31-13(3)24)14-10-17(27)20-15(25)7-8-16(26)21(20)22(14)29/h6-8,10,18,25-26H,9,11H2,1-5H3/t18-/m0/s1

SMILES: CC(=CC[C@@H](C1=CC(=O)c2c(ccc(c2C1=O)O)O)OC(=O)CC(C)(C)OC(=O)C)C

Synonyms:

• Butanoic acid, 3-(acetyloxy)-3-methyl-, 1-(1,4-dihydro-5,8-dihydroxy-1,4-dioxo-2-naphthalenyl)-4-methyl-3-pentenyl ester, (S)-

β-acetoxyisovalerylalkannin

CAS: 69091-17-4

Formula: C₂₃H₂₆O₈

Molecular weight: 430.45

Ref: 7W-GY6735

β-Acetoxyisovalerylshikonin

CAS: 69091-17-4

β-Acetoxyisovalerylshikonin

Purity: ≥98%

Molecular weight: 430.45g/mol

Ref: 54-BUP08901

β-acetoxyisovalerylalkannin

CAS: 69091-17-4

Formula: C₂₃H₂₆O₈

Purity: 95%~99%

Color and Shape: Red powder

Molecular weight: 430.453

Ref: BP-BP3409

β-Acetoxyisovalerylshikonin

CAS: 69091-17-4

Beta-Acetoxyisovalerylshikonin is a naphthoquinone derivative extracted from Arnebia euchroma.Cost-effective and quality-assured.

Formula: C₂₃H₂₆O₈

Purity: 99.5% - 99.63%

Color and Shape: Solid

Molecular weight: 430.45

Ref: TM-T5S2350