CAS 69095-07-4

Bicyclo[2.2.1]heptane-1-methanamine, hydrochloride (1:1)

Description:

Bicyclo[2.2.1]heptane-1-methanamine, hydrochloride (1:1), with the CAS number 69095-07-4, is a chemical compound characterized by its bicyclic structure, which consists of a seven-membered ring system. This compound features a methanamine functional group, indicating the presence of an amine (-NH2) attached to the bicyclic framework. As a hydrochloride salt, it is typically encountered in a stable, crystalline form, which enhances its solubility in water and makes it easier to handle in various applications. The bicyclic structure contributes to its unique chemical properties, including potential applications in medicinal chemistry and organic synthesis. The presence of the amine group suggests that it may participate in various chemical reactions, such as alkylation or acylation, and could serve as a building block for more complex molecules. Additionally, the hydrochloride form often indicates that the compound may exhibit basic properties, making it relevant in biological systems or as a potential pharmaceutical agent. Overall, this compound's structural features and functional groups make it of interest in both research and industrial contexts.

Formula: C₈H₁₅N·ClH

InChI: InChI=1S/C8H15N.ClH/c9-6-8-3-1-7(5-8)2-4-8;/h7H,1-6,9H2;1H

InChI key: InChIKey=NOQQTKRMYUJOCY-UHFFFAOYSA-N

SMILES: C(N)C12CC(CC1)CC2.Cl

Synonyms:

• Bicyclo[2.2.1]heptane-1-methanamine, hydrochloride
• [Bicyclo[2.2.1]heptan-1-yl]methanamine hydrochloride
• Bicyclo[2.2.1]heptane-1-methanamine, hydrochloride (1:1)

{Bicyclo[2.2.1]heptan-1-yl}methanamine hydrochloride

CAS: 69095-07-4

Versatile small molecule scaffold

Formula: C₈H₁₆ClN

Purity: Min. 95%

Molecular weight: 161.67 g/mol

Ref: 3D-UCA09507