CAS 69099-74-7

2,4,4a,5-tetrahydro-3H-indeno[1,2-c]pyridazin-3-one

Description:

2,4,4a,5-tetrahydro-3H-indeno[1,2-c]pyridazin-3-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both indene and pyridazine moieties. This compound typically exhibits a fused ring system that contributes to its stability and potential reactivity. It is generally a solid at room temperature and may display moderate solubility in organic solvents, depending on the specific conditions. The presence of the pyridazinone functional group suggests potential biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various functionalization possibilities, which can enhance its pharmacological properties. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, 2,4,4a,5-tetrahydro-3H-indeno[1,2-c]pyridazin-3-one represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₁H₁₀N₂O

InChI: InChI=1/C11H10N2O/c14-10-6-8-5-7-3-1-2-4-9(7)11(8)13-12-10/h1-4,8H,5-6H2,(H,12,14)

SMILES: c1ccc2c(c1)CC1CC(=NN=C21)O

2H,3H,4H,4aH,5H-Indeno[1,2-c]pyridazin-3-one

CAS: 69099-74-7

Versatile small molecule scaffold

Formula: C₁₁H₁₀N₂O

Purity: Min. 95%

Molecular weight: 186.21 g/mol

Ref: 3D-UCA09974