CAS 690991-18-5

N-[4-(1-methylpropyl)phenyl]-3-oxobutanamide

Description:

N-[4-(1-methylpropyl)phenyl]-3-oxobutanamide, identified by its CAS number 690991-18-5, is an organic compound characterized by its amide functional group and a ketone moiety. This substance features a phenyl ring substituted with a branched alkyl group (1-methylpropyl), which contributes to its hydrophobic properties. The presence of the 3-oxobutanamide structure indicates that it has both carbonyl and amide functionalities, which can influence its reactivity and interactions with biological systems. Typically, compounds of this nature may exhibit moderate to high lipophilicity, affecting their solubility in organic solvents versus water. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such compounds may serve as intermediates or active ingredients. Additionally, the specific arrangement of functional groups can lead to unique biological activities, making it a subject of interest in medicinal chemistry. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₄H₁₉NO₂

InChI: InChI=1/C14H19NO2/c1-4-10(2)12-5-7-13(8-6-12)15-14(17)9-11(3)16/h5-8,10H,4,9H2,1-3H3,(H,15,17)

SMILES: CCC(C)c1ccc(cc1)NC(=O)CC(=O)C

Synonyms:

• butanamide, N-[4-(1-methylpropyl)phenyl]-3-oxo-
• N-(4-sec-Butylphenyl)-3-oxobutanamide

N-(4-Sec-butylphenyl)-3-oxobutanamide

CAS: 690991-18-5

Formula: C₁₄H₁₉NO₂

Molecular weight: 233.3062

Ref: IN-DA005L82

N-(4-sec-butylphenyl)-3-oxobutanamide

CAS: 690991-18-5

Formula: C₁₄H₁₉NO₂

Purity: 95.0%

Molecular weight: 233.311

Ref: 10-F315441