CAS 691007-05-3
:(Z)-(2,4-Difluorophenyl)-4-piperidinylmethanone oxime
Description:
(Z)-(2,4-Difluorophenyl)-4-piperidinylmethanone oxime, with the CAS number 691007-05-3, is a chemical compound characterized by its unique structural features. It contains a difluorophenyl group, which contributes to its electronic properties and potential reactivity. The presence of the piperidine ring adds to its basicity and can influence its interaction with biological targets. The oxime functional group is notable for its ability to form stable complexes with metal ions and can participate in various chemical reactions, including condensation and rearrangement. This compound may exhibit specific pharmacological activities, making it of interest in medicinal chemistry. Its stereochemistry, indicated by the (Z) configuration, suggests a particular spatial arrangement that can affect its biological activity and binding affinity. Overall, the combination of these structural elements suggests that this compound could have applications in drug development or as a research tool in chemical biology.
Formula:C12H14F2N2O
InChI:InChI=1S/C12H14F2N2O/c13-9-1-2-10(11(14)7-9)12(16-17)8-3-5-15-6-4-8/h1-2,7-8,15,17H,3-6H2/b16-12-
SMILES:c1cc(c(cc1F)F)/C(=N\O)/C1CCNCC1
Synonyms:- (Z)-(2,4-difluorophenyl)-4-piperidinyl-Methanone oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.
(Z)-4-(2,4-Difluorobenzoyl)piperidine Oxime
CAS:Formula:C12H14F2N2OColor and Shape:SolidMolecular weight:240.2492Iloperidone Impurity 31
CAS:Formula:C12H14F2N2OColor and Shape:White To Off-White SolidMolecular weight:240.25(Z)-4-(2,4-Difluorobenzoyl)piperidine Oxime
CAS:Controlled ProductApplications Intermediate in the preparation of Risperidone (R525000) and it’s derivatives.
Formula:C12H14F2N2OColor and Shape:NeatMolecular weight:240.2492




